* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | IMIDAZO[1,2-A]PYRIMIDINE-5(1H)-THIONE |
CAS: | 57473-34-4 |
English Synonyms: | IMIDAZO[1,2-A]PYRIMIDINE-5(1H)-THIONE |
MDL Number.: | MFCD18833877 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cnc2[nH]ccn2c1=S |
InChi: | InChI=1S/C6H5N3S/c10-5-1-2-7-6-8-3-4-9(5)6/h1-4H,(H,7,8) |
InChiKey: | InChIKey=XBDWPLQDSSKDKV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.