* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BICYCLO[2.2.1]HEPT-5-ENE-2-CARBOXYLIC ACID, 2-METHYL-, (1R,2S,4R)- |
CAS: | 575465-35-9 |
English Synonyms: | BICYCLO[2.2.1]HEPT-5-ENE-2-CARBOXYLIC ACID, 2-METHYL-, (1R,2S,4R)- |
MDL Number.: | MFCD18828919 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C[C@@]1(C[C@H]2C[C@@H]1C=C2)C(=O)O |
InChi: | InChI=1S/C9H12O2/c1-9(8(10)11)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3,(H,10,11)/t6-,7+,9+/m1/s1 |
InChiKey: | InChIKey=JIHFJSOMLKXSSQ-FJXKBIBVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.