* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,5-DIHYDRO-2-(6-METHOXY[1,1':4',1''-TERPHENYL]-2-YL)-4,4-DIMETHYL-OXAZOLE |
CAS: | 57598-36-4 |
English Synonyms: | 4,5-DIHYDRO-2-(6-METHOXY[1,1':4',1''-TERPHENYL]-2-YL)-4,4-DIMETHYL-OXAZOLE ; OXAZOLE, 4,5-DIHYDRO-2-(6-METHOXY[1,1':4',1''-TERPHENYL]-2-YL)-4,4-DIMETHYL- |
MDL Number.: | MFCD17677377 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1(COC(=N1)c2cccc(c2c3ccc(cc3)c4ccccc4)OC)C |
InChi: | InChI=1S/C24H23NO2/c1-24(2)16-27-23(25-24)20-10-7-11-21(26-3)22(20)19-14-12-18(13-15-19)17-8-5-4-6-9-17/h4-15H,16H2,1-3H3 |
InChiKey: | InChIKey=BFXCAPSIWXDLCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.