* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-(2',6-DIMETHOXY[1,1'-BIPHENYL]-2-YL)-4,5-DIHYDRO-4,4-DIMETHYL-OXAZOLE |
CAS: | 57598-39-7 |
English Synonyms: | OXAZOLE, 2-(2',6-DIMETHOXY[1,1'-BIPHENYL]-2-YL)-4,5-DIHYDRO-4,4-DIMETHYL- ; 2-(2',6-DIMETHOXY[1,1'-BIPHENYL]-2-YL)-4,5-DIHYDRO-4,4-DIMETHYL-OXAZOLE |
MDL Number.: | MFCD17677201 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC1(COC(=N1)c2cccc(c2c3ccccc3OC)OC)C |
InChi: | InChI=1S/C19H21NO3/c1-19(2)12-23-18(20-19)14-9-7-11-16(22-4)17(14)13-8-5-6-10-15(13)21-3/h5-11H,12H2,1-4H3 |
InChiKey: | InChIKey=IKBOBOPHNVAPHB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.