* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6,7,8,9-TETRAHYDRO-5H-IMIDAZO[1,2-A]AZEPINE |
| CAS: | 5768-55-8 |
| English Synonyms: | 6,7,8,9-TETRAHYDRO-5H-IMIDAZO[1,2-A]AZEPINE |
| MDL Number.: | MFCD11870772 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cn2c(n1)CCCCC2 |
| InChi: | InChI=1S/C8H12N2/c1-2-4-8-9-5-7-10(8)6-3-1/h5,7H,1-4,6H2 |
| InChiKey: | InChIKey=MBVCARRYXQUTLF-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.