* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | NUFENOXOLE |
| CAS: | 57726-65-5 |
| English Synonyms: | NUFENOXOLE |
| MDL Number.: | MFCD00870662 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | Cc1nnc(o1)C(CCN2C[C@@H]3CC[C@H]2CC3)(c4ccccc4)c5ccccc5 |
| InChi: | InChI=1S/C25H29N3O/c1-19-26-27-24(29-19)25(21-8-4-2-5-9-21,22-10-6-3-7-11-22)16-17-28-18-20-12-14-23(28)15-13-20/h2-11,20,23H,12-18H2,1H3/t20-,23+ |
| InChiKey: | InChIKey=CVOCKGAVXLCEGM-UHGJSFDGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.