* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SULTOSILIC ACID |
| CAS: | 57775-26-5 |
| English Synonyms: | SULTOSILIC ACID |
| MDL Number.: | MFCD00865738 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)S(=O)(=O)Oc2ccc(c(c2)S(=O)(=O)O)O |
| InChi: | InChI=1S/C13H12O7S2/c1-9-2-5-11(6-3-9)22(18,19)20-10-4-7-12(14)13(8-10)21(15,16)17/h2-8,14H,1H3,(H,15,16,17) |
| InChiKey: | InChIKey=SVXZTCUBEFUKRQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.