* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-TRP-TRP-OH |
| CAS: | 57850-17-6 |
| English Synonyms: | Z-TRP-TRP-OH |
| MDL Number.: | MFCD00022760 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](Cc2c[nH]c3c2cccc3)C(=O)N[C@@H](Cc4c[nH]c5c4cccc5)C(=O)O |
| InChi: | InChI=1S/C30H28N4O5/c35-28(33-27(29(36)37)15-21-17-32-25-13-7-5-11-23(21)25)26(14-20-16-31-24-12-6-4-10-22(20)24)34-30(38)39-18-19-8-2-1-3-9-19/h1-13,16-17,26-27,31-32H,14-15,18H2,(H,33,35)(H,34,38)(H,36,37)/t26-,27-/m0/s1 |
| InChiKey: | InChIKey=IGVSKBFIFVGVSE-SVBPBHIXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.