* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOGLYCITEIN |
CAS: | 57960-04-0 |
English Synonyms: | ISOGLYCITEIN ; KAKKATIN |
MDL Number.: | MFCD00467743 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | COc1cc2c(cc1O)C(C(=CO2)c3ccc(cc3)O)O |
InChi: | InChI=1S/C16H14O5/c1-20-15-7-14-11(6-13(15)18)16(19)12(8-21-14)9-2-4-10(17)5-3-9/h2-8,16-19H,1H3 |
InChiKey: | InChIKey=GDNFTAZGPOAVIK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.