* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-PHENYL-CINNOLINE HCL |
CAS: | 58045-60-6 |
English Synonyms: | 4-PHENYL-CINNOLINE HCL |
MDL Number.: | MFCD18642550 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)c2cnnc3c2cccc3.Cl |
InChi: | InChI=1S/C14H10N2.ClH/c1-2-6-11(7-3-1)13-10-15-16-14-9-5-4-8-12(13)14;/h1-10H;1H |
InChiKey: | InChIKey=NLFMILGTWWICBX-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.