* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (R)-(+)-T-BUTYL 2-(P-TOLYLSULFINYL)ACETATE |
CAS: | 58059-08-8 |
English Synonyms: | (R)-(+)-T-BUTYL 2-(P-TOLYLSULFINYL)ACETATE |
MDL Number.: | MFCD17019266 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | Cc1ccc(cc1)[S@](=O)CC(=O)OC(C)(C)C |
InChi: | InChI=1S/C13H18O3S/c1-10-5-7-11(8-6-10)17(15)9-12(14)16-13(2,3)4/h5-8H,9H2,1-4H3/t17-/m1/s1 |
InChiKey: | InChIKey=ATKQQTNXMNHRCW-QGZVFWFLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.