* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-NITRO-9H-FLUOREN-9-OL |
CAS: | 58084-75-6 |
English Synonyms: | 9-HYDROXY-3-NITROFLUORENE) ; 3-NITRO-9H-FLUOREN-9-OL |
MDL Number.: | MFCD00011713 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)-c3cc(ccc3C2O)[N+](=O)[O-] |
InChi: | InChI=1S/C13H9NO3/c15-13-10-4-2-1-3-9(10)12-7-8(14(16)17)5-6-11(12)13/h1-7,13,15H |
InChiKey: | InChIKey=SRAZCUGEAYIAKK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.