* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [3,3']BIPYRIDINYL |
CAS: | 581-46-4 |
English Synonyms: | 3-(PYRIDIN-3-YL)PYRIDINE ; [3,3']BIPYRIDINYL ; 3,3'-BIPYRIDINE |
MDL Number.: | MFCD00006371 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1cc(cnc1)c2cccnc2 |
InChi: | InChI=1S/C10H8N2/c1-3-9(7-11-5-1)10-4-2-6-12-8-10/h1-8H |
InChiKey: | InChIKey=OFDVABAUFQJWEZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.