* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XI-006 |
| CAS: | 58131-57-0 |
| English Synonyms: | NSC 207895 ; XI-006 |
| MDL Number.: | MFCD01660065 |
| H bond acceptor: | 9 |
| H bond donor: | 0 |
| Smile: | CN1CCN(CC1)c2ccc(c3c2[n+](on3)[O-])[N+](=O)[O-] |
| InChi: | InChI=1S/C11H13N5O4/c1-13-4-6-14(7-5-13)9-3-2-8(15(17)18)10-11(9)16(19)20-12-10/h2-3H,4-7H2,1H3 |
| InChiKey: | InChIKey=MWFZDJLPWDCQIL-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.