* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | KAKKALIDE |
CAS: | 58274-56-9 |
English Synonyms: | KAKKALIDE |
MDL Number.: | MFCD09970384 |
H bond acceptor: | 15 |
H bond donor: | 7 |
Smile: | COc1ccc(cc1)c2coc3cc(c(c(c3c2=O)O)OC)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO[C@H]5[C@@H]([C@H]([C@@H](CO5)O)O)O)O)O)O |
InChi: | InChI=1S/C28H32O15/c1-37-12-5-3-11(4-6-12)13-8-39-15-7-16(26(38-2)22(33)18(15)19(13)30)42-28-25(36)23(34)21(32)17(43-28)10-41-27-24(35)20(31)14(29)9-40-27/h3-8,14,17,20-21,23-25,27-29,31-36H,9-10H2,1-2H3/t14-,17-,20+,21-,23+,24-,25-,27+,28-/m1/s1 |
InChiKey: | InChIKey=QTVAYNGFFDZGDR-CIJVEFAYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.