Molecular Structure:
CAS No.:
58331-99-0
Product Name.:
CCD No.:CCD07192097
Formula:C10 H6 N2 O2
MolWeight:186.169
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(4)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | METHYL 2,4-DICYANOBENZOATE |
| CAS： | 58331-99-0 |
| English Synonyms： | METHYL 2,4-DICYANOBENZOATE |
| MDL Number.： | MFCD22199275 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | COC(=O)c1ccc(cc1C#N)C#N |
| InChi： | InChI=1S/C10H6N2O2/c1-14-10(13)9-3-2-7(5-11)4-8(9)6-12/h2-4H,1H3 |
| InChiKey： | InChIKey=BFYWDZMBOCCUIO-UHFFFAOYSA-N |
|
|
| Comments： | WARNINGS: IRRITANT |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
