* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1-(8-BROMO-4-ETHYL-PYRAZOLO[5,1-C][1,2,4]TRIAZIN-3-YL)-PROPAN-1-ONE |
CAS: | 58390-63-9 |
English Synonyms: | 1-(8-BROMO-4-ETHYL-PYRAZOLO[5,1-C][1,2,4]TRIAZIN-3-YL)-PROPAN-1-ONE |
MDL Number.: | MFCD18073616 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CCc1c(nnc2n1ncc2Br)C(=O)CC |
InChi: | InChI=1S/C10H11BrN4O/c1-3-7-9(8(16)4-2)13-14-10-6(11)5-12-15(7)10/h5H,3-4H2,1-2H3 |
InChiKey: | InChIKey=JIKVZTLFABFRHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.