* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 8-BROMO-4-PROPYL-PYRAZOLO[5,1-C][1,2,4]TRIAZINE |
CAS: | 58457-20-8 |
English Synonyms: | 8-BROMO-4-PROPYL-PYRAZOLO[5,1-C][1,2,4]TRIAZINE ; 8-BROMO-4-PROPYLPYRAZOLO[3,2-C][1,2,4]TRIAZINE |
MDL Number.: | MFCD18073615 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCCc1cnnc2n1ncc2Br |
InChi: | InChI=1S/C8H9BrN4/c1-2-3-6-4-10-12-8-7(9)5-11-13(6)8/h4-5H,2-3H2,1H3 |
InChiKey: | InChIKey=DIKBMTWTSKMBOB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.