* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9,10-EPOXY-9,10-DIHYDROPHENANTHRENE |
CAS: | 585-08-0 |
English Synonyms: | 9,10-EPOXY-9,10-DIHYDROPHENANTHRENE |
MDL Number.: | MFCD01708798 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)-c3ccccc3C4C2O4 |
InChi: | InChI=1S/C14H10O/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)14-13(11)15-14/h1-8,13-14H |
InChiKey: | InChIKey=PXPGRGGVENWVBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.