* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-BENZYL-5,6-DIMETHYL-1H-1,3-BENZODIAZOLE |
CAS: | 58506-60-8 |
English Synonyms: | 2-BENZYL-5,6-DIMETHYL-1H-1,3-BENZODIAZOLE |
MDL Number.: | MFCD00085389 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1cc2c(cc1C)nc([nH]2)Cc3ccccc3 |
InChi: | InChI=1S/C16H16N2/c1-11-8-14-15(9-12(11)2)18-16(17-14)10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H,17,18) |
InChiKey: | InChIKey=OMNBEKIHRZTXSS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.