* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ETHYL 2-(4-OXOPYRIDIN-1(4H)-YL)ACETATE |
CAS: | 58530-44-2 |
English Synonyms: | ETHYL 2-(4-OXOPYRIDIN-1(4H)-YL)ACETATE |
MDL Number.: | MFCD17240364 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCOC(=O)Cn1ccc(=O)cc1 |
InChi: | InChI=1S/C9H11NO3/c1-2-13-9(12)7-10-5-3-8(11)4-6-10/h3-6H,2,7H2,1H3 |
InChiKey: | InChIKey=GUHKHJRFMVASHE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.