* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 4,7-METHANO-1H-INDEN-1-OL, 2,3,3A,4,7,7A-HEXAHYDRO-, (1R,3AS,4R,7S,7AR)- |
CAS: | 585544-39-4 |
English Synonyms: | 4,7-METHANO-1H-INDEN-1-OL, 2,3,3A,4,7,7A-HEXAHYDRO-, (1R,3AS,4R,7S,7AR)- |
MDL Number.: | MFCD18828389 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C1C[C@H]([C@@H]2[C@@H]1[C@@H]3C[C@H]2C=C3)O |
InChi: | InChI=1S/C10H14O/c11-9-4-3-8-6-1-2-7(5-6)10(8)9/h1-2,6-11H,3-5H2/t6-,7+,8-,9+,10-/m0/s1 |
InChiKey: | InChIKey=NZHBXAIWRAYMLP-LRPJSKTQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.