* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,7-DIIODONAPHTHALENE |
CAS: | 58556-77-7 |
English Synonyms: | 2,7-DIIODONAPHTHALENE |
MDL Number.: | MFCD17012329 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | c1cc(cc2c1ccc(c2)I)I |
InChi: | InChI=1S/C10H6I2/c11-9-3-1-7-2-4-10(12)6-8(7)5-9/h1-6H |
InChiKey: | InChIKey=VKWGMCDDHNYOBD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.