* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5,6,7,8-TETRAHYDRO-4(1H)-QUINOLINONE |
CAS: | 58596-31-9 |
English Synonyms: | 5,6,7,8-TETRAHYDRO-4(1H)-QUINOLINONE |
MDL Number.: | MFCD18427840 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1c[nH]c2c(c1=O)CCCC2 |
InChi: | InChI=1S/C9H11NO/c11-9-5-6-10-8-4-2-1-3-7(8)9/h5-6H,1-4H2,(H,10,11) |
InChiKey: | InChIKey=ZGJDQLDCBPXGGF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.