* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TPS-OH |
CAS: | 58621-56-0 |
English Synonyms: | TPS-OH |
MDL Number.: | MFCD09263505 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | [OH-].C1=CC=C(C=C1)[S+](C1=CC=CC=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C18H15S.H2O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h1-15H;1H2/q+1;/p-1 |
InChiKey: | InChIKey=KOFQUBYAUWJFIT-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.