* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | (1R,5R)-1-AZABICYCLO[3.2.1]OCTAN-3-ONE |
CAS: | 586363-77-1 |
English Synonyms: | (1R,5R)-1-AZABICYCLO[3.2.1]OCTAN-3-ONE ; 1-AZABICYCLO[3.2.1]OCTAN-3-ONE, (1R,5R)- |
MDL Number.: | MFCD18835058 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C1CN2C[C@H]1CC(=O)C2 |
InChi: | InChI=1S/C7H11NO/c9-7-3-6-1-2-8(4-6)5-7/h6H,1-5H2/t6-/m1/s1 |
InChiKey: | InChIKey=KNHZVHKPTBBLRA-ZCFIWIBFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.