* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2(1H)-PYRIDINONE, 4-PHENOXY- |
CAS: | 586387-34-0 |
English Synonyms: | 2(1H)-PYRIDINONE, 4-PHENOXY- ; 4-PHENOXY-2(1H)-PYRIDINONE |
MDL Number.: | MFCD18831248 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)Oc2cc[nH]c(=O)c2 |
InChi: | InChI=1S/C11H9NO2/c13-11-8-10(6-7-12-11)14-9-4-2-1-3-5-9/h1-8H,(H,12,13) |
InChiKey: | InChIKey=ZVABDPNQEHMTGA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.