* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-PYRROLIDINEACETIC ACID, 5-CARBOXY-, (2S,5S)- |
CAS: | 586409-91-8 |
English Synonyms: | 2-PYRROLIDINEACETIC ACID, 5-CARBOXY-, (2S,5S)- |
MDL Number.: | MFCD18833472 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C1C[C@H](N[C@@H]1CC(=O)O)C(=O)O |
InChi: | InChI=1S/C7H11NO4/c9-6(10)3-4-1-2-5(8-4)7(11)12/h4-5,8H,1-3H2,(H,9,10)(H,11,12)/t4-,5-/m0/s1 |
InChiKey: | InChIKey=LIZWYFXJOOUDNV-WHFBIAKZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.