* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 1,7-NAPHTHYRIDIN-4-AMINE |
CAS: | 58680-41-4 |
English Synonyms: | 4-AMINO-1,7-NAPHTHYRIDINE ; 1,7-NAPHTHYRIDIN-4-AMINE |
MDL Number.: | MFCD18384659 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cncc2c1c(ccn2)N |
InChi: | InChI=1S/C8H7N3/c9-7-2-4-11-8-5-10-3-1-6(7)8/h1-5H,(H2,9,11) |
InChiKey: | InChIKey=PHFKUTFUFKZJMV-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.