* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,1,3-TRIETHOXYBUTANE |
CAS: | 5870-82-6 |
English Synonyms: | 1,1,3-TRIETHOXYBUTANE ; BUTANE, 1,1,3-TRIETHOXY- |
MDL Number.: | MFCD00026931 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CCOC(C)CC(OCC)OCC |
InChi: | InChI=1S/C10H22O3/c1-5-11-9(4)8-10(12-6-2)13-7-3/h9-10H,5-8H2,1-4H3 |
InChiKey: | InChIKey=MDIBXLWYZGZAKL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.