* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VERACEVINE |
| CAS: | 5876-23-3 |
| English Synonyms: | VERACEVINE |
| MDL Number.: | MFCD01732127 |
| H bond acceptor: | 9 |
| H bond donor: | 7 |
| Smile: | C[C@H]1CC[C@H]2[C@@]([C@]3([C@H](C[C@]4([C@@H]5CC[C@H]6[C@]7([C@]5(C[C@]4([C@@H]3CN2C1)O)O[C@]6([C@H](CC7)O)O)C)O)O)O)(C)O |
| InChi: | InChI=1S/C27H43NO8/c1-14-4-7-18-22(3,31)26(34)17(12-28(18)11-14)24(33)13-25-16(23(24,32)10-20(26)30)6-5-15-21(25,2)9-8-19(29)27(15,35)36-25/h14-20,29-35H,4-13H2,1-3H3/t14-,15-,16-,17-,18-,19-,20-,21-,22+,23+,24+,25+,26-,27+/m0/s1 |
| InChiKey: | InChIKey=MZHXYVMEVBEFAL-IQMVPAROSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.