* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-OXAZOLIDINONE, 3-(1-ETHYL-1H-PYRROL-2-YL)-5-(HYDROXYMETHYL)-, (5R)- |
CAS: | 587869-29-2 |
English Synonyms: | 2-OXAZOLIDINONE, 3-(1-ETHYL-1H-PYRROL-2-YL)-5-(HYDROXYMETHYL)-, (5R)- |
MDL Number.: | MFCD18835913 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCn1cccc1N2C[C@@H](OC2=O)CO |
InChi: | InChI=1S/C10H14N2O3/c1-2-11-5-3-4-9(11)12-6-8(7-13)15-10(12)14/h3-5,8,13H,2,6-7H2,1H3/t8-/m1/s1 |
InChiKey: | InChIKey=LXQCPSSDRPNXGV-MRVPVSSYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.