* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BICYCLO[2.2.1]HEPT-5-ENE-2-CARBOXALDEHYDE, 3-ACETYL-, (1S,2R,3S,4R)- |
CAS: | 587875-56-7 |
English Synonyms: | BICYCLO[2.2.1]HEPT-5-ENE-2-CARBOXALDEHYDE, 3-ACETYL-, (1S,2R,3S,4R)- |
MDL Number.: | MFCD18829647 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC(=O)[C@H]1[C@H]2C[C@H]([C@H]1C=O)C=C2 |
InChi: | InChI=1S/C10H12O2/c1-6(12)10-8-3-2-7(4-8)9(10)5-11/h2-3,5,7-10H,4H2,1H3/t7-,8-,9-,10+/m1/s1 |
InChiKey: | InChIKey=PIGVZYHJMXOEQI-KYXWUPHJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.