* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | Z-GLY-PRO-ALA-OH |
CAS: | 5891-41-8 |
English Synonyms: | Z-GLY-PRO-ALA-OH |
MDL Number.: | MFCD00238460 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | C[C@@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)CNC(=O)OCc2ccccc2 |
InChi: | InChI=1S/C18H23N3O6/c1-12(17(24)25)20-16(23)14-8-5-9-21(14)15(22)10-19-18(26)27-11-13-6-3-2-4-7-13/h2-4,6-7,12,14H,5,8-11H2,1H3,(H,19,26)(H,20,23)(H,24,25)/t12-,14-/m0/s1 |
InChiKey: | InChIKey=PYRIIPBSDFLGNG-JSGCOSHPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.