* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | H-ASP-LYS-OH |
CAS: | 5891-51-0 |
English Synonyms: | H-ASP-LYS-OH ; L-ASP-L-LYS |
MDL Number.: | MFCD00038206 |
H bond acceptor: | 8 |
H bond donor: | 5 |
Smile: | C(CCN)C[C@@H](C(=O)O)NC(=O)[C@H](CC(=O)O)N |
InChi: | InChI=1S/C10H19N3O5/c11-4-2-1-3-7(10(17)18)13-9(16)6(12)5-8(14)15/h6-7H,1-5,11-12H2,(H,13,16)(H,14,15)(H,17,18)/t6-,7-/m0/s1 |
InChiKey: | InChIKey=OAMLVOVXNKILLQ-BQBZGAKWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.