* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,4,6-TRI-SEC-BUTYLPHENOL |
CAS: | 5892-47-7 |
English Synonyms: | 2,4,6-TRI-SEC-BUTYLPHENOL |
MDL Number.: | MFCD00059394 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | CCC(C)c1cc(c(c(c1)C(C)CC)O)C(C)CC |
InChi: | InChI=1S/C18H30O/c1-7-12(4)15-10-16(13(5)8-2)18(19)17(11-15)14(6)9-3/h10-14,19H,7-9H2,1-6H3 |
InChiKey: | InChIKey=LAVMWOGIDKQCDK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.