* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | H-PHE-GLY-PHE-GLY-OH |
| CAS: | 59005-83-3 |
| English Synonyms: | PHE-GLY-PHE-GLY ; H-PHE-GLY-PHE-GLY-OH |
| MDL Number.: | MFCD00133757 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | c1ccc(cc1)C[C@@H](C(=O)NCC(=O)N[C@@H](Cc2ccccc2)C(=O)NCC(=O)O)N |
| InChi: | InChI=1S/C22H26N4O5/c23-17(11-15-7-3-1-4-8-15)21(30)24-13-19(27)26-18(22(31)25-14-20(28)29)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14,23H2,(H,24,30)(H,25,31)(H,26,27)(H,28,29)/t17-,18-/m0/s1 |
| InChiKey: | InChIKey=QVOBNSFUVPLVPE-ROUUACIJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.