* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-BROMO-2-ETHYL-2H-INDAZOLE |
CAS: | 590417-97-3 |
English Synonyms: | 2H-INDAZOLE,5-BROMO-2-ETHYL- ; 5-BROMO-2-ETHYL-2H-INDAZOLE |
MDL Number.: | MFCD18434483 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCn1cc2cc(ccc2n1)Br |
InChi: | InChI=1S/C9H9BrN2/c1-2-12-6-7-5-8(10)3-4-9(7)11-12/h3-6H,2H2,1H3 |
InChiKey: | InChIKey=HQGWVFUIGSFDSL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.