* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-BROMO-4-METHYLFURAN-2,5-DIONE |
CAS: | 59107-74-3 |
English Synonyms: | 3-BROMO-4-METHYLFURAN-2,5-DIONE |
MDL Number.: | MFCD18205875 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | CC1=C(C(=O)OC1=O)Br |
InChi: | InChI=1S/C5H3BrO3/c1-2-3(6)5(8)9-4(2)7/h1H3 |
InChiKey: | InChIKey=AFFQJNROJVXRMN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.