* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Serine, O-phenyl- |
CAS: | 59123-22-7 |
English Synonyms: | SERINE, O-PHENYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC=C1)OC[C@H](N)C(=O)O |
InChi: | InChI=1S/C9H11NO3/c10-8(9(11)12)6-13-7-4-2-1-3-5-7/h1-5,8H,6,10H2,(H,11,12)/t8-/m0/s1 |
InChiKey: | InChIKey=JQBDLDSXPJLCFK-QMMMGPOBSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.