* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-AZABICYCLO[4.1.0]HEPTA-1(7),2,4-TRIENE |
CAS: | 591245-09-9 |
English Synonyms: | 3-AZABICYCLO[4.1.0]HEPTA-1(7),2,4-TRIENE ; 3-AZABICYCLO[4.1.0]HEPTA-2,4,7-TRIENE |
MDL Number.: | MFCD18817594 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | C1=CN=CC2=CC21 |
InChi: | InChI=1S/C6H5N/c1-2-7-4-6-3-5(1)6/h1-5H |
InChiKey: | InChIKey=DTVOYDLHKYYUKV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.