* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 5-(ETHYLAMINO)PENTAN-2-ONE |
CAS: | 59127-80-9 |
English Synonyms: | 5-(ETHYLAMINO)PENTAN-2-ONE |
MDL Number.: | MFCD18821317 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCNCCCC(=O)C |
InChi: | InChI=1S/C7H15NO/c1-3-8-6-4-5-7(2)9/h8H,3-6H2,1-2H3 |
InChiKey: | InChIKey=CAEPSWSOZBVDEO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.