* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-BENZYL-1,3-DIMETHYL-1H-PYRAZOL-5-AMINE |
CAS: | 59166-14-2 |
English Synonyms: | 4-BENZYL-1,3-DIMETHYL-1H-PYRAZOL-5-AMINE |
MDL Number.: | MFCD11558413 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1c(c(n(n1)C)N)Cc2ccccc2 |
InChi: | InChI=1S/C12H15N3/c1-9-11(12(13)15(2)14-9)8-10-6-4-3-5-7-10/h3-7H,8,13H2,1-2H3 |
InChiKey: | InChIKey=LQZHHXTXUYZCDO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.