* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2,4-DIMETHOXY-6-(1-PIPERAZINYL)-1,3,5-TRIAZINE |
CAS: | 59215-46-2 |
English Synonyms: | 2,4-DIMETHOXY-6-(1-PIPERAZINYL)-1,3,5-TRIAZINE ; 2,4-DIMETHOXY-6-(PIPERAZIN-1-YL)-1,3,5-TRIAZINE |
MDL Number.: | MFCD17271256 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | COc1nc(nc(n1)OC)N2CCNCC2 |
InChi: | InChI=1S/C9H15N5O2/c1-15-8-11-7(12-9(13-8)16-2)14-5-3-10-4-6-14/h10H,3-6H2,1-2H3 |
InChiKey: | InChIKey=HSVSVRAXWDFERV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.