* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (Z)-2-METHYL-4-PROPYL-1,3-OXATHIANE |
| CAS: | 59323-76-1 |
| English Synonyms: | (Z)-2-METHYL-4-PROPYL-1,3-OXATHIANE |
| MDL Number.: | MFCD16885724 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | CCC[C@H]1CCO[C@H](S1)C |
| InChi: | InChI=1S/C8H16OS/c1-3-4-8-5-6-9-7(2)10-8/h7-8H,3-6H2,1-2H3/t7-,8+/m1/s1 |
| InChiKey: | InChIKey=GKGOLPMYJJXRGD-SFYZADRCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.