* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-(-)-IDOSE |
CAS: | 5934-56-5 |
English Synonyms: | L-IDOSE ; (3R,4S,5S,6S)-6-(HYDROXYMETHYL)TETRAHYDRO-2H-PYRAN-2,3,4,5-TETROL ; L-(-)-IDOSE ; (3R,4S,5S,6S)-6-(HYDROXYMETHYL)OXANE-2,3,4,5-TETROL |
MDL Number.: | MFCD00069825 |
H bond acceptor: | 6 |
H bond donor: | 5 |
Smile: | C([C@H]1[C@H]([C@@H]([C@H](C(O1)O)O)O)O)O |
InChi: | InChI=1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3+,4-,5+,6?/m0/s1 |
InChiKey: | InChIKey=WQZGKKKJIJFFOK-ZNVMLXAYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.