* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PERFLISOPENT |
CAS: | 594-91-2 |
English Synonyms: | PERFLISOPENT |
MDL Number.: | MFCD09837991 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C(C(F)(F)F)(F)F)(C(F)(F)F)(C(F)(F)F)F |
InChi: | InChI=1S/C5F12/c6-1(3(9,10)11,4(12,13)14)2(7,8)5(15,16)17 |
InChiKey: | InChIKey=MPEFSWGYIJNMCW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.