* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CARPIPRAMINE |
| CAS: | 5942-95-0 |
| English Synonyms: | CARPIPRAMINE |
| MDL Number.: | MFCD00242877 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)CCc3ccccc3N2CCCN4CCC(CC4)(C(=O)N)N5CCCCC5 |
| InChi: | InChI=1S/C28H38N4O/c29-27(33)28(31-18-6-1-7-19-31)15-21-30(22-16-28)17-8-20-32-25-11-4-2-9-23(25)13-14-24-10-3-5-12-26(24)32/h2-5,9-12H,1,6-8,13-22H2,(H2,29,33) |
| InChiKey: | InChIKey=NWPJLRSCSQHPJV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.