Molecular Structure:
CAS No.:
59444-69-8
Product Name.:
CCD No.:CCD04014239
Formula:C11 H7 Br N2
MolWeight:247.094
![6-BROMO-9H-PYRIDO[3,4-B]INDOLE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(2)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | 6-BROMO-9H-PYRIDO[3,4-B]INDOLE |
| CAS： | 59444-69-8 |
| English Synonyms： | ABBYPHARMA AP-30-2221 ; 6-BROMO-9H-PYRIDO[3,4-B]INDOLE |
| MDL Number.： | MFCD18254658 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1cc2c(cc1Br)c3ccncc3[nH]2 |
| InChi： | InChI=1S/C11H7BrN2/c12-7-1-2-10-9(5-7)8-3-4-13-6-11(8)14-10/h1-6,14H |
| InChiKey： | InChIKey=DNUXGDOJLQYUTO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
