Molecular Structure:
CAS No.:
59468-86-9
Product Name.:
CCD No.:CCD04012161
Formula:C18 H13 Cl F N3 O
MolWeight:341.772
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(3)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | MIDAZOLAM 2-OXIDE |
| CAS： | 59468-86-9 |
| English Synonyms： | MIDAZOLAM 2-OXIDE |
| MDL Number.： | MFCD18252526 |
| H bond acceptor： | 4 |
| H bond donor： | 0 |
| Smile： | Cc1n-2c(c[n+]1[O-])CN=C(c3c2ccc(c3)Cl)c4ccccc4F |
| InChi： | InChI=1S/C18H13ClFN3O/c1-11-22(24)10-13-9-21-18(14-4-2-3-5-16(14)20)15-8-12(19)6-7-17(15)23(11)13/h2-8,10H,9H2,1H3 |
| InChiKey： | InChIKey=QVPQNEQZMOGERL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
